C28H41BrFN3O4SSi — CID 140892537
tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-5-methyl-1-(pyrrolidine-1-carbonyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 140892537) has the molecular formula C28H41BrFN3O4SSi and a molecular weight of 642.71 g/mol. Its IUPAC name is tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-5-methyl-1-(pyrrolidine-1-carbonyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-5-methyl-1-(pyrrolidine-1-carbonyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 140892537 |
| Molecular Formula | C28H41BrFN3O4SSi |
| Molecular Weight | 642.71 g/mol |
| Exact Mass | 641.18 |
| IUPAC Name | tert-butyl N-[(1S,5S,6S)-5-(5-bromo-2-fluorophenyl)-5-methyl-1-(pyrrolidine-1-carbonyl)-2-thia-4-azabicyclo[4.1.0]hept-3-en-3-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)C1=N[C@](C)(c2cc(Br)ccc2F)[C@@H]2C[C@]2(C(=O)N2CCCC2)S1 |
| InChI | InChI=1S/C28H41BrFN3O4SSi/c1-26(2,3)37-25(35)33(18-36-14-15-39(5,6)7)24-31-27(4,20-16-19(29)10-11-21(20)30)22-17-28(22,38-24)23(34)32-12-8-9-13-32/h10-11,16,22H,8-9,12-15,17-18H2,1-7H3/t22-,27+,28-/m0/s1 |
| InChIKey | CLACRUSYGHXKAM-ZGOJTZKKSA-N |
| XLogP | 6.84 |
| TPSA | 71.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.71 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|