C7H10O8S — CID 131836363
3,4-dihydroxy-5-sulfooxycyclohexene-1-carboxylic acid (PubChem CID 131836363) has the molecular formula C7H10O8S and a molecular weight of 254.22 g/mol. Its IUPAC name is 3,4-dihydroxy-5-sulfooxycyclohexene-1-carboxylic acid.
| Compound Name | 3,4-dihydroxy-5-sulfooxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 131836363 |
| Molecular Formula | C7H10O8S |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 3,4-dihydroxy-5-sulfooxycyclohexene-1-carboxylic acid |
| SMILES | O=C(O)C1=CC(O)C(O)C(OS(=O)(=O)O)C1 |
| InChI | InChI=1S/C7H10O8S/c8-4-1-3(7(10)11)2-5(6(4)9)15-16(12,13)14/h1,4-6,8-9H,2H2,(H,10,11)(H,12,13,14) |
| InChIKey | XXVMMNIWHJCWRV-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|