3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid

C9H14O3 — CID 59477067

IUPAC3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid
SMILESCC1CC(C(=O)O)=CC(O)C1C
InChIInChI=1S/C9H14O3/c1-5-3-7(9(11)12)4-8(10)6(5)2/h4-6,8,10H,3H2,1-2H3,(H,11,12)
InChIKeyFFLXCIUKFMBYMG-UHFFFAOYSA-N
MW170.21 g/mol
LogP1.03
Rot. Bonds1

About 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid

3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid (PubChem CID 59477067) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid.

Molecular Properties

Compound Name3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid
PubChem CID59477067
Molecular FormulaC9H14O3
Molecular Weight170.21 g/mol
Exact Mass170.09
IUPAC Name3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid
SMILESCC1CC(C(=O)O)=CC(O)C1C
InChIInChI=1S/C9H14O3/c1-5-3-7(9(11)12)4-8(10)6(5)2/h4-6,8,10H,3H2,1-2H3,(H,11,12)
InChIKeyFFLXCIUKFMBYMG-UHFFFAOYSA-N
XLogP1.03
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.21
LogP ≤ 51.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid?
The IUPAC name of 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid (CID 59477067) is 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid.
What is the SMILES notation for 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid?
The canonical SMILES for 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid is CC1CC(C(=O)O)=CC(O)C1C.
What is the InChIKey of 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid?
The InChIKey is FFLXCIUKFMBYMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3/c1-5-3-7(9(11)12)4-8(10)6(5)2/h4-6,8,10H,3H2,1-2H3,(H,11,12).
What are the key properties of 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid?
3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid has a molecular weight of 170.21 g/mol, XLogP of 1.03, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid is sourced from PubChem (CID 59477067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).