C9H14O3 — CID 59477067
3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid (PubChem CID 59477067) has the molecular formula C9H14O3 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid.
| Compound Name | 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 59477067 |
| Molecular Formula | C9H14O3 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 3-hydroxy-4,5-dimethylcyclohexene-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)=CC(O)C1C |
| InChI | InChI=1S/C9H14O3/c1-5-3-7(9(11)12)4-8(10)6(5)2/h4-6,8,10H,3H2,1-2H3,(H,11,12) |
| InChIKey | FFLXCIUKFMBYMG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |