C8H13O7P — CID 162154749
4-hydroxy-5-methyl-3-phosphonooxycyclohexene-1-carboxylic acid (PubChem CID 162154749) has the molecular formula C8H13O7P and a molecular weight of 252.16 g/mol. Its IUPAC name is 4-hydroxy-5-methyl-3-phosphonooxycyclohexene-1-carboxylic acid.
| Compound Name | 4-hydroxy-5-methyl-3-phosphonooxycyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 162154749 |
| Molecular Formula | C8H13O7P |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 4-hydroxy-5-methyl-3-phosphonooxycyclohexene-1-carboxylic acid |
| SMILES | CC1CC(C(=O)O)=CC(OP(=O)(O)O)C1O |
| InChI | InChI=1S/C8H13O7P/c1-4-2-5(8(10)11)3-6(7(4)9)15-16(12,13)14/h3-4,6-7,9H,2H2,1H3,(H,10,11)(H2,12,13,14) |
| InChIKey | OYRVXRMZWYOTCG-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|