C14H15ClN4 — CID 131842858
8-benzyl-2-chloro-4-methyl-6,7-dihydro-5H-pteridine (PubChem CID 131842858) has the molecular formula C14H15ClN4 and a molecular weight of 274.75 g/mol. Its IUPAC name is 8-benzyl-2-chloro-4-methyl-6,7-dihydro-5H-pteridine.
| Compound Name | 8-benzyl-2-chloro-4-methyl-6,7-dihydro-5H-pteridine |
|---|---|
| PubChem CID | 131842858 |
| Molecular Formula | C14H15ClN4 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 8-benzyl-2-chloro-4-methyl-6,7-dihydro-5H-pteridine |
| SMILES | Cc1nc(Cl)nc2c1NCCN2Cc1ccccc1 |
| InChI | InChI=1S/C14H15ClN4/c1-10-12-13(18-14(15)17-10)19(8-7-16-12)9-11-5-3-2-4-6-11/h2-6,16H,7-9H2,1H3 |
| InChIKey | TZEKMUWTUKGJKW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |