About (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane
(2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane (PubChem CID 131844967) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane.
Molecular Properties
| Compound Name | (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane |
| PubChem CID | 131844967 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane |
| SMILES | COc1cc(OC)cc([C@@H]2O[C@H]2c2ccccc2)c1 |
| InChI | InChI=1S/C16H16O3/c1-17-13-8-12(9-14(10-13)18-2)16-15(19-16)11-6-4-3-5-7-11/h3-10,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | WKNMNSSEJVDUTP-HOTGVXAUSA-N |
| XLogP | 3.52 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane?
The IUPAC name of (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane (CID 131844967) is (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane.
What is the SMILES notation for (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane?
The canonical SMILES for (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane is COc1cc(OC)cc([C@@H]2O[C@H]2c2ccccc2)c1.
What is the InChIKey of (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane?
The InChIKey is WKNMNSSEJVDUTP-HOTGVXAUSA-N. The full InChI is InChI=1S/C16H16O3/c1-17-13-8-12(9-14(10-13)18-2)16-15(19-16)11-6-4-3-5-7-11/h3-10,15-16H,1-2H3/t15-,16-/m0/s1.
What are the key properties of (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane?
(2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane has a molecular weight of 256.30 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-(3,5-dimethoxyphenyl)-3-phenyloxirane is sourced from PubChem (CID 131844967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).