C12H20O — CID 131845051
(2R,6S)-2-cyclohexyl-6-methyl-3,6-dihydro-2H-pyran (PubChem CID 131845051) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (2R,6S)-2-cyclohexyl-6-methyl-3,6-dihydro-2H-pyran.
| Compound Name | (2R,6S)-2-cyclohexyl-6-methyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 131845051 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2R,6S)-2-cyclohexyl-6-methyl-3,6-dihydro-2H-pyran |
| SMILES | C[C@H]1C=CC[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C12H20O/c1-10-6-5-9-12(13-10)11-7-3-2-4-8-11/h5-6,10-12H,2-4,7-9H2,1H3/t10-,12+/m0/s1 |
| InChIKey | GNSOUURHHDYNBR-CMPLNLGQSA-N |
| XLogP | 3.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|