C11H12O5S — CID 131846445
ethyl (1S,2R,6S,7R,8S)-3,5-dioxo-10-oxa-4-thiatricyclo[5.2.1.02,6]decane-8-carboxylate (PubChem CID 131846445) has the molecular formula C11H12O5S and a molecular weight of 256.28 g/mol. Its IUPAC name is ethyl (1S,2R,6S,7R,8S)-3,5-dioxo-10-oxa-4-thiatricyclo[5.2.1.02,6]decane-8-carboxylate.
| Compound Name | ethyl (1S,2R,6S,7R,8S)-3,5-dioxo-10-oxa-4-thiatricyclo[5.2.1.02,6]decane-8-carboxylate |
|---|---|
| PubChem CID | 131846445 |
| Molecular Formula | C11H12O5S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.04 |
| IUPAC Name | ethyl (1S,2R,6S,7R,8S)-3,5-dioxo-10-oxa-4-thiatricyclo[5.2.1.02,6]decane-8-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H]2O[C@H]1[C@H]1C(=O)SC(=O)[C@H]12 |
| InChI | InChI=1S/C11H12O5S/c1-2-15-9(12)4-3-5-6-7(8(4)16-5)11(14)17-10(6)13/h4-8H,2-3H2,1H3/t4-,5-,6-,7-,8+/m0/s1 |
| InChIKey | XOCQTVSSYNHWTF-DMHSOCPYSA-N |
| XLogP | 0.37 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|