C24H28N2O4 — CID 131847948
tert-butyl 4-[[4-[(5-formyl-2-oxo-1-pyridinyl)methyl]phenyl]methylidene]piperidine-1-carboxylate (PubChem CID 131847948) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is tert-butyl 4-[[4-[(5-formyl-2-oxo-1-pyridinyl)methyl]phenyl]methylidene]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-[(5-formyl-2-oxo-1-pyridinyl)methyl]phenyl]methylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 131847948 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | tert-butyl 4-[[4-[(5-formyl-2-oxo-1-pyridinyl)methyl]phenyl]methylidene]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=Cc2ccc(Cn3cc(C=O)ccc3=O)cc2)CC1 |
| InChI | InChI=1S/C24H28N2O4/c1-24(2,3)30-23(29)25-12-10-19(11-13-25)14-18-4-6-20(7-5-18)15-26-16-21(17-27)8-9-22(26)28/h4-9,14,16-17H,10-13,15H2,1-3H3 |
| InChIKey | FUSVHXVSYHNATR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|