C13H10O3S — CID 131848252
4-(benzenesulfonylmethylidene)cyclohexa-2,5-dien-1-one (PubChem CID 131848252) has the molecular formula C13H10O3S and a molecular weight of 246.29 g/mol. Its IUPAC name is 4-(benzenesulfonylmethylidene)cyclohexa-2,5-dien-1-one.
| Compound Name | 4-(benzenesulfonylmethylidene)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 131848252 |
| Molecular Formula | C13H10O3S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.04 |
| IUPAC Name | 4-(benzenesulfonylmethylidene)cyclohexa-2,5-dien-1-one |
| SMILES | O=C1C=CC(=CS(=O)(=O)c2ccccc2)C=C1 |
| InChI | InChI=1S/C13H10O3S/c14-12-8-6-11(7-9-12)10-17(15,16)13-4-2-1-3-5-13/h1-10H |
| InChIKey | HRFMNFUOIAVCNJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |