C10H9N3O2S — CID 134891737
(5E)-5-(benzenesulfonylmethylidene)-2H-1,2,4-triazine (PubChem CID 134891737) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is (5E)-5-(benzenesulfonylmethylidene)-2H-1,2,4-triazine.
| Compound Name | (5E)-5-(benzenesulfonylmethylidene)-2H-1,2,4-triazine |
|---|---|
| PubChem CID | 134891737 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | (5E)-5-(benzenesulfonylmethylidene)-2H-1,2,4-triazine |
| SMILES | O=S(=O)(/C=C1\C=NNC=N1)c1ccccc1 |
| InChI | InChI=1S/C10H9N3O2S/c14-16(15,10-4-2-1-3-5-10)7-9-6-12-13-8-11-9/h1-8H,(H,11,13)/b9-7+ |
| InChIKey | NLXWILJTHBLZRF-VQHVLOKHSA-N |
| XLogP | 0.92 |
| TPSA | 70.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |