C19H18O3S — CID 99959638
(1R,3R,5S,7R,8S,9S,10S,11S)-6-(benzenesulfonylmethylidene)pentacyclo[5.4.1.03,10.05,9.08,11]dodecan-2-one (PubChem CID 99959638) has the molecular formula C19H18O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is (1R,3R,5S,7R,8S,9S,10S,11S)-6-(benzenesulfonylmethylidene)pentacyclo[5.4.1.03,10.05,9.08,11]dodecan-2-one.
| Compound Name | (1R,3R,5S,7R,8S,9S,10S,11S)-6-(benzenesulfonylmethylidene)pentacyclo[5.4.1.03,10.05,9.08,11]dodecan-2-one |
|---|---|
| PubChem CID | 99959638 |
| Molecular Formula | C19H18O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | (1R,3R,5S,7R,8S,9S,10S,11S)-6-(benzenesulfonylmethylidene)pentacyclo[5.4.1.03,10.05,9.08,11]dodecan-2-one |
| SMILES | O=C1[C@@H]2C[C@H]3/C(=C\S(=O)(=O)c4ccccc4)[C@H]4C[C@@H]1[C@H]1[C@@H]4[C@H]3[C@@H]12 |
| InChI | InChI=1S/C19H18O3S/c20-19-12-6-10-14(8-23(21,22)9-4-2-1-3-5-9)11-7-13(19)18-16(11)15(10)17(12)18/h1-5,8,10-13,15-18H,6-7H2/b14-8-/t10-,11+,12-,13-,15+,16+,17+,18+/m1/s1 |
| InChIKey | ZAPMCPUSTKKAOA-PXFBFGGRSA-N |
| XLogP | 2.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |