C22H31NO2 — CID 131850210
(2S)-2-naphthalen-2-yloxy-N,N-dipropylhexanamide (PubChem CID 131850210) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is (2S)-2-naphthalen-2-yloxy-N,N-dipropylhexanamide.
| Compound Name | (2S)-2-naphthalen-2-yloxy-N,N-dipropylhexanamide |
|---|---|
| PubChem CID | 131850210 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | (2S)-2-naphthalen-2-yloxy-N,N-dipropylhexanamide |
| SMILES | CCCC[C@H](Oc1ccc2ccccc2c1)C(=O)N(CCC)CCC |
| InChI | InChI=1S/C22H31NO2/c1-4-7-12-21(22(24)23(15-5-2)16-6-3)25-20-14-13-18-10-8-9-11-19(18)17-20/h8-11,13-14,17,21H,4-7,12,15-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | OYSFVQGDXFDGAF-NRFANRHFSA-N |
| XLogP | 5.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |