C17H35NO2 — CID 131850924
(2S,3R)-2-butyl-N,N-diethyl-3-hydroxynonanamide (PubChem CID 131850924) has the molecular formula C17H35NO2 and a molecular weight of 285.47 g/mol. Its IUPAC name is (2S,3R)-2-butyl-N,N-diethyl-3-hydroxynonanamide.
| Compound Name | (2S,3R)-2-butyl-N,N-diethyl-3-hydroxynonanamide |
|---|---|
| PubChem CID | 131850924 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | (2S,3R)-2-butyl-N,N-diethyl-3-hydroxynonanamide |
| SMILES | CCCCCC[C@@H](O)[C@H](CCCC)C(=O)N(CC)CC |
| InChI | InChI=1S/C17H35NO2/c1-5-9-11-12-14-16(19)15(13-10-6-2)17(20)18(7-3)8-4/h15-16,19H,5-14H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | RORGSILUUUCKRY-JKSUJKDBSA-N |
| XLogP | 3.99 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|