C9H9N3O — CID 131851349
N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylidene]hydroxylamine (PubChem CID 131851349) has the molecular formula C9H9N3O and a molecular weight of 175.19 g/mol. Its IUPAC name is N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylidene]hydroxylamine.
| Compound Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 131851349 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-[(8-methylimidazo[1,2-a]pyridin-3-yl)methylidene]hydroxylamine |
| SMILES | Cc1cccn2c(C=NO)cnc12 |
| InChI | InChI=1S/C9H9N3O/c1-7-3-2-4-12-8(6-11-13)5-10-9(7)12/h2-6,13H,1H3 |
| InChIKey | FBQNPFJDHVYOFC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 49.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|