C15H13N5O2S — CID 5426638
3-[(Z)-hydroxyiminomethyl]-9-methyl-2-(4-methylpyrimidin-2-yl)sulfanylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 5426638) has the molecular formula C15H13N5O2S and a molecular weight of 327.37 g/mol. Its IUPAC name is 3-[(Z)-hydroxyiminomethyl]-9-methyl-2-(4-methylpyrimidin-2-yl)sulfanylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(Z)-hydroxyiminomethyl]-9-methyl-2-(4-methylpyrimidin-2-yl)sulfanylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 5426638 |
| Molecular Formula | C15H13N5O2S |
| Molecular Weight | 327.37 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-[(Z)-hydroxyiminomethyl]-9-methyl-2-(4-methylpyrimidin-2-yl)sulfanylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccnc(Sc2nc3c(C)cccn3c(=O)c2/C=N\O)n1 |
| InChI | InChI=1S/C15H13N5O2S/c1-9-4-3-7-20-12(9)19-13(11(8-17-22)14(20)21)23-15-16-6-5-10(2)18-15/h3-8,22H,1-2H3/b17-8- |
| InChIKey | PNUCFIDIMCGKSC-IUXPMGMMSA-N |
| XLogP | 2.06 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|