C24H18N4O2S — CID 21178109
2-(1,3-benzoxazol-2-ylsulfanyl)-3-(benzyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 21178109) has the molecular formula C24H18N4O2S and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylsulfanyl)-3-(benzyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-3-(benzyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 21178109 |
| Molecular Formula | C24H18N4O2S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylsulfanyl)-3-(benzyliminomethyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)c(/C=N/Cc3ccccc3)c(Sc3nc4ccccc4o3)nc12 |
| InChI | InChI=1S/C24H18N4O2S/c1-16-8-7-13-28-21(16)27-22(31-24-26-19-11-5-6-12-20(19)30-24)18(23(28)29)15-25-14-17-9-3-2-4-10-17/h2-13,15H,14H2,1H3/b25-15+ |
| InChIKey | NTQKNBIEFNYAIU-MFKUBSTISA-N |
| XLogP | 4.91 |
| TPSA | 72.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|