C15H13NOS2 — CID 164898168
2-(2-phenylethyldisulfanyl)-1,3-benzoxazole (PubChem CID 164898168) has the molecular formula C15H13NOS2 and a molecular weight of 287.41 g/mol. Its IUPAC name is 2-(2-phenylethyldisulfanyl)-1,3-benzoxazole.
| Compound Name | 2-(2-phenylethyldisulfanyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 164898168 |
| Molecular Formula | C15H13NOS2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 2-(2-phenylethyldisulfanyl)-1,3-benzoxazole |
| SMILES | c1ccc(CCSSc2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C15H13NOS2/c1-2-6-12(7-3-1)10-11-18-19-15-16-13-8-4-5-9-14(13)17-15/h1-9H,10-11H2 |
| InChIKey | LKKLOSUOFDAGLD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|