C24H16N6OS3 — CID 4648456
3-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-(1,3-benzothiazol-2-ylsulfanyl)-9-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 4648456) has the molecular formula C24H16N6OS3 and a molecular weight of 500.63 g/mol. Its IUPAC name is 3-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-(1,3-benzothiazol-2-ylsulfanyl)-9-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 3-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-(1,3-benzothiazol-2-ylsulfanyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 4648456 |
| Molecular Formula | C24H16N6OS3 |
| Molecular Weight | 500.63 g/mol |
| Exact Mass | 500.05 |
| IUPAC Name | 3-[(1,3-benzothiazol-2-ylhydrazinylidene)methyl]-2-(1,3-benzothiazol-2-ylsulfanyl)-9-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cccn2c(=O)c(C=NNc3nc4ccccc4s3)c(Sc3nc4ccccc4s3)nc12 |
| InChI | InChI=1S/C24H16N6OS3/c1-14-7-6-12-30-20(14)28-21(34-24-27-17-9-3-5-11-19(17)33-24)15(22(30)31)13-25-29-23-26-16-8-2-4-10-18(16)32-23/h2-13H,1H3,(H,26,29) |
| InChIKey | GXFBIORKSMDSEQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 84.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.63 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|