C9H15N — CID 131852005
3-ethyl-1-azatricyclo[3.2.1.02,7]octane (PubChem CID 131852005) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is 3-ethyl-1-azatricyclo[3.2.1.02,7]octane.
| Compound Name | 3-ethyl-1-azatricyclo[3.2.1.02,7]octane |
|---|---|
| PubChem CID | 131852005 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | 3-ethyl-1-azatricyclo[3.2.1.02,7]octane |
| SMILES | CCC1CC2CC3C1N3C2 |
| InChI | InChI=1S/C9H15N/c1-2-7-3-6-4-8-9(7)10(8)5-6/h6-9H,2-5H2,1H3 |
| InChIKey | MBIQXMDAOOUNCV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|