C17H22N4O2 — CID 131854027
N-[[5-(dimethylamino)furan-2-yl]methylideneamino]-2-(3,4-dimethylanilino)acetamide (PubChem CID 131854027) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[[5-(dimethylamino)furan-2-yl]methylideneamino]-2-(3,4-dimethylanilino)acetamide.
| Compound Name | N-[[5-(dimethylamino)furan-2-yl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 131854027 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[[5-(dimethylamino)furan-2-yl]methylideneamino]-2-(3,4-dimethylanilino)acetamide |
| SMILES | Cc1ccc(NCC(=O)NN=Cc2ccc(N(C)C)o2)cc1C |
| InChI | InChI=1S/C17H22N4O2/c1-12-5-6-14(9-13(12)2)18-11-16(22)20-19-10-15-7-8-17(23-15)21(3)4/h5-10,18H,11H2,1-4H3,(H,20,22) |
| InChIKey | WVUZDCVYCXWNTK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|