C15H15Cl2N3O2 — CID 6069375
2-(3,4-dichlorophenyl)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]acetamide (PubChem CID 6069375) has the molecular formula C15H15Cl2N3O2 and a molecular weight of 340.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]acetamide.
| Compound Name | 2-(3,4-dichlorophenyl)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]acetamide |
|---|---|
| PubChem CID | 6069375 |
| Molecular Formula | C15H15Cl2N3O2 |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N-[(Z)-[5-(dimethylamino)furan-2-yl]methylideneamino]acetamide |
| SMILES | CN(C)c1ccc(/C=N\NC(=O)Cc2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C15H15Cl2N3O2/c1-20(2)15-6-4-11(22-15)9-18-19-14(21)8-10-3-5-12(16)13(17)7-10/h3-7,9H,8H2,1-2H3,(H,19,21)/b18-9- |
| InChIKey | IXRJLRDVNVBMEY-NVMNQCDNSA-N |
| XLogP | 3.35 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_furan_A(15)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|