C11H22N2O — CID 131858364
N-[3,3,4,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-yl]acetamide (PubChem CID 131858364) has the molecular formula C11H22N2O and a molecular weight of 215.41 g/mol. Its IUPAC name is N-[3,3,4,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-yl]acetamide.
| Compound Name | N-[3,3,4,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 131858364 |
| Molecular Formula | C11H22N2O |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.28 |
| IUPAC Name | N-[3,3,4,5,5-pentadeuterio-2,2,6,6-tetrakis(trideuteriomethyl)piperidin-4-yl]acetamide |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])NC(C([2H])([2H])[2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])(NC(C)=O)C1([2H])[2H] |
| InChI | InChI=1S/C11H22N2O/c1-8(14)12-9-6-10(2,3)13-11(4,5)7-9/h9,13H,6-7H2,1-5H3,(H,12,14)/i2D3,3D3,4D3,5D3,6D2,7D2,9D |
| InChIKey | HVXYQAREJSKQNE-DZAIYLDHSA-N |
| XLogP | 1.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |