C10H15N — CID 131858796
1-[(1S,2R)-2-methylcyclopentyl]pyrrole (PubChem CID 131858796) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclopentyl]pyrrole.
| Compound Name | 1-[(1S,2R)-2-methylcyclopentyl]pyrrole |
|---|---|
| PubChem CID | 131858796 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclopentyl]pyrrole |
| SMILES | C[C@@H]1CCC[C@@H]1n1cccc1 |
| InChI | InChI=1S/C10H15N/c1-9-5-4-6-10(9)11-7-2-3-8-11/h2-3,7-10H,4-6H2,1H3/t9-,10+/m1/s1 |
| InChIKey | IIFIVULCXNBLQG-ZJUUUORDSA-N |
| XLogP | 2.85 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |