C8H9BrO — CID 131859974
1-bromotricyclo[3.2.1.02,7]octan-3-one (PubChem CID 131859974) has the molecular formula C8H9BrO and a molecular weight of 201.06 g/mol. Its IUPAC name is 1-bromotricyclo[3.2.1.02,7]octan-3-one.
| Compound Name | 1-bromotricyclo[3.2.1.02,7]octan-3-one |
|---|---|
| PubChem CID | 131859974 |
| Molecular Formula | C8H9BrO |
| Molecular Weight | 201.06 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | 1-bromotricyclo[3.2.1.02,7]octan-3-one |
| SMILES | O=C1CC2CC3C1C3(Br)C2 |
| InChI | InChI=1S/C8H9BrO/c9-8-3-4-1-5(8)7(8)6(10)2-4/h4-5,7H,1-3H2 |
| InChIKey | NKIHLCARNTYQGA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.06 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|