C10H10O5 — CID 131860326
1-(4-hydroxy-6-oxopyran-2-yl)pentane-2,4-dione (PubChem CID 131860326) has the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. Its IUPAC name is 1-(4-hydroxy-6-oxopyran-2-yl)pentane-2,4-dione.
| Compound Name | 1-(4-hydroxy-6-oxopyran-2-yl)pentane-2,4-dione |
|---|---|
| PubChem CID | 131860326 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 1-(4-hydroxy-6-oxopyran-2-yl)pentane-2,4-dione |
| SMILES | CC(=O)CC(=O)Cc1cc(O)cc(=O)o1 |
| InChI | InChI=1S/C10H10O5/c1-6(11)2-7(12)3-9-4-8(13)5-10(14)15-9/h4-5,13H,2-3H2,1H3 |
| InChIKey | ASEYYXCDIJFBOF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|