C12H10O5 — CID 102304306
6,8-dihydroxy-3-(2-oxopropyl)isochromen-1-one (PubChem CID 102304306) has the molecular formula C12H10O5 and a molecular weight of 234.21 g/mol. Its IUPAC name is 6,8-dihydroxy-3-(2-oxopropyl)isochromen-1-one.
| Compound Name | 6,8-dihydroxy-3-(2-oxopropyl)isochromen-1-one |
|---|---|
| PubChem CID | 102304306 |
| Molecular Formula | C12H10O5 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 6,8-dihydroxy-3-(2-oxopropyl)isochromen-1-one |
| SMILES | CC(=O)Cc1cc2cc(O)cc(O)c2c(=O)o1 |
| InChI | InChI=1S/C12H10O5/c1-6(13)2-9-4-7-3-8(14)5-10(15)11(7)12(16)17-9/h3-5,14-15H,2H2,1H3 |
| InChIKey | ASXQQFFJWJUYLO-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |