C25H30O6 — CID 38356110
8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentylisochromen-1-one (PubChem CID 38356110) has the molecular formula C25H30O6 and a molecular weight of 426.51 g/mol. Its IUPAC name is 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentylisochromen-1-one.
| Compound Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentylisochromen-1-one |
|---|---|
| PubChem CID | 38356110 |
| Molecular Formula | C25H30O6 |
| Molecular Weight | 426.51 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentylisochromen-1-one |
| SMILES | CCCCCc1cc2cc(O)cc(Oc3c(O)cc(O)cc3CCCCC)c2c(=O)o1 |
| InChI | InChI=1S/C25H30O6/c1-3-5-7-9-16-11-18(26)14-21(28)24(16)31-22-15-19(27)12-17-13-20(10-8-6-4-2)30-25(29)23(17)22/h11-15,26-28H,3-10H2,1-2H3 |
| InChIKey | NXAFAINHPNBMLG-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.51 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|