C25H33NO5 — CID 139383120
8-(2,4-dihydroxy-6-pentylphenoxy)-3-pentyl-1,2-dihydroquinoline-2,6-diol (PubChem CID 139383120) has the molecular formula C25H33NO5 and a molecular weight of 427.54 g/mol. Its IUPAC name is 8-(2,4-dihydroxy-6-pentylphenoxy)-3-pentyl-1,2-dihydroquinoline-2,6-diol.
| Compound Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-3-pentyl-1,2-dihydroquinoline-2,6-diol |
|---|---|
| PubChem CID | 139383120 |
| Molecular Formula | C25H33NO5 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-3-pentyl-1,2-dihydroquinoline-2,6-diol |
| SMILES | CCCCCC1=Cc2cc(O)cc(Oc3c(O)cc(O)cc3CCCCC)c2NC1O |
| InChI | InChI=1S/C25H33NO5/c1-3-5-7-9-16-12-19(27)14-21(29)24(16)31-22-15-20(28)13-18-11-17(10-8-6-4-2)25(30)26-23(18)22/h11-15,25-30H,3-10H2,1-2H3 |
| InChIKey | DJNDBINNTOAESM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|