C25H31NO5 — CID 129247224
8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one (PubChem CID 129247224) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one.
| Compound Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 129247224 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one |
| SMILES | CCCCCc1cc(O)cc(O)c1Oc1cc(O)cc2cc(CCCCC)c(=O)[nH]c12 |
| InChI | InChI=1S/C25H31NO5/c1-3-5-7-9-16-12-19(27)14-21(29)24(16)31-22-15-20(28)13-18-11-17(10-8-6-4-2)25(30)26-23(18)22/h11-15,27-29H,3-10H2,1-2H3,(H,26,30) |
| InChIKey | JTGJKWVNZIWEFJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|