About 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one
8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one (PubChem CID 129247224) has the molecular formula C25H31NO5
and a molecular weight of 425.53 g/mol. Its IUPAC name is 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one |
| PubChem CID | 129247224 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one |
| SMILES | CCCCCc1cc(O)cc(O)c1Oc1cc(O)cc2cc(CCCCC)c(=O)[nH]c12 |
| InChI | InChI=1S/C25H31NO5/c1-3-5-7-9-16-12-19(27)14-21(29)24(16)31-22-15-20(28)13-18-11-17(10-8-6-4-2)25(30)26-23(18)22/h11-15,27-29H,3-10H2,1-2H3,(H,26,30) |
| InChIKey | JTGJKWVNZIWEFJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one?
The IUPAC name of 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one (CID 129247224) is 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one.
What is the SMILES notation for 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one?
The canonical SMILES for 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one is CCCCCc1cc(O)cc(O)c1Oc1cc(O)cc2cc(CCCCC)c(=O)[nH]c12.
What is the InChIKey of 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one?
The InChIKey is JTGJKWVNZIWEFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H31NO5/c1-3-5-7-9-16-12-19(27)14-21(29)24(16)31-22-15-20(28)13-18-11-17(10-8-6-4-2)25(30)26-23(18)22/h11-15,27-29H,3-10H2,1-2H3,(H,26,30).
What are the key properties of 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one?
8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one has a molecular weight of 425.53 g/mol, XLogP of 5.90, 10 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dihydroxy-6-pentylphenoxy)-6-hydroxy-3-pentyl-1H-quinolin-2-one is sourced from PubChem (CID 129247224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).