C24H30O7 — CID 163015250
(3R)-3-butyl-7-(2,4-dihydroxy-6-pentylphenoxy)-3-hydroxy-5-methoxy-2-benzofuran-1-one (PubChem CID 163015250) has the molecular formula C24H30O7 and a molecular weight of 430.50 g/mol. Its IUPAC name is (3R)-3-butyl-7-(2,4-dihydroxy-6-pentylphenoxy)-3-hydroxy-5-methoxy-2-benzofuran-1-one.
| Compound Name | (3R)-3-butyl-7-(2,4-dihydroxy-6-pentylphenoxy)-3-hydroxy-5-methoxy-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163015250 |
| Molecular Formula | C24H30O7 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | (3R)-3-butyl-7-(2,4-dihydroxy-6-pentylphenoxy)-3-hydroxy-5-methoxy-2-benzofuran-1-one |
| SMILES | CCCCCc1cc(O)cc(O)c1Oc1cc(OC)cc2c1C(=O)O[C@]2(O)CCCC |
| InChI | InChI=1S/C24H30O7/c1-4-6-8-9-15-11-16(25)12-19(26)22(15)30-20-14-17(29-3)13-18-21(20)23(27)31-24(18,28)10-7-5-2/h11-14,25-26,28H,4-10H2,1-3H3/t24-/m1/s1 |
| InChIKey | PDZXHKSZUJKQQU-XMMPIXPASA-N |
| XLogP | 5.14 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|