C28H34O7 — CID 133188375
8-[2,4-dihydroxy-6-(2-oxoheptyl)phenoxy]-6-methoxy-3-pentylisochromen-1-one (PubChem CID 133188375) has the molecular formula C28H34O7 and a molecular weight of 482.57 g/mol. Its IUPAC name is 8-[2,4-dihydroxy-6-(2-oxoheptyl)phenoxy]-6-methoxy-3-pentylisochromen-1-one.
| Compound Name | 8-[2,4-dihydroxy-6-(2-oxoheptyl)phenoxy]-6-methoxy-3-pentylisochromen-1-one |
|---|---|
| PubChem CID | 133188375 |
| Molecular Formula | C28H34O7 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 8-[2,4-dihydroxy-6-(2-oxoheptyl)phenoxy]-6-methoxy-3-pentylisochromen-1-one |
| SMILES | CCCCCC(=O)Cc1cc(O)cc(O)c1Oc1cc(OC)cc2cc(CCCCC)oc(=O)c12 |
| InChI | InChI=1S/C28H34O7/c1-4-6-8-10-20(29)12-19-13-21(30)16-24(31)27(19)35-25-17-23(33-3)15-18-14-22(11-9-7-5-2)34-28(32)26(18)25/h13-17,30-31H,4-12H2,1-3H3 |
| InChIKey | ZTNGNNBLGMSYJR-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|