C12H12O6 — CID 24882464
3-[(2R)-2,3-dihydroxypropyl]-6,8-dihydroxyisochromen-1-one (PubChem CID 24882464) has the molecular formula C12H12O6 and a molecular weight of 252.22 g/mol. Its IUPAC name is 3-[(2R)-2,3-dihydroxypropyl]-6,8-dihydroxyisochromen-1-one.
| Compound Name | 3-[(2R)-2,3-dihydroxypropyl]-6,8-dihydroxyisochromen-1-one |
|---|---|
| PubChem CID | 24882464 |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 3-[(2R)-2,3-dihydroxypropyl]-6,8-dihydroxyisochromen-1-one |
| SMILES | O=c1oc(C[C@@H](O)CO)cc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C12H12O6/c13-5-8(15)3-9-2-6-1-7(14)4-10(16)11(6)12(17)18-9/h1-2,4,8,13-16H,3,5H2/t8-/m1/s1 |
| InChIKey | VILYFHCPBMAWFN-MRVPVSSYSA-N |
| XLogP | 0.10 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |