C8H8N2O5 — CID 131862542
2,3-dihydrofuro[3,4-b][1,4]dioxine-5,7-dicarboxamide (PubChem CID 131862542) has the molecular formula C8H8N2O5 and a molecular weight of 212.16 g/mol. Its IUPAC name is 2,3-dihydrofuro[3,4-b][1,4]dioxine-5,7-dicarboxamide.
| Compound Name | 2,3-dihydrofuro[3,4-b][1,4]dioxine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 131862542 |
| Molecular Formula | C8H8N2O5 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 2,3-dihydrofuro[3,4-b][1,4]dioxine-5,7-dicarboxamide |
| SMILES | NC(=O)c1oc(C(N)=O)c2c1OCCO2 |
| InChI | InChI=1S/C8H8N2O5/c9-7(11)5-3-4(14-2-1-13-3)6(15-5)8(10)12/h1-2H2,(H2,9,11)(H2,10,12) |
| InChIKey | YYSGFJQSZJLQIS-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |