About CID 131863452
CID 131863452 (PubChem CID 131863452) has the molecular formula C8H5ClN2NaO3S
and a molecular weight of 267.65 g/mol.
Molecular Properties
| Compound Name | CID 131863452 |
| PubChem CID | 131863452 |
| Molecular Formula | C8H5ClN2NaO3S |
| Molecular Weight | 267.65 g/mol |
| Exact Mass | 266.96 |
| IUPAC Name | — |
| SMILES | N#CC(=NO)S(=O)(=O)c1ccc(Cl)cc1.[Na] |
| InChI | InChI=1S/C8H5ClN2O3S.Na/c9-6-1-3-7(4-2-6)15(13,14)8(5-10)11-12;/h1-4,12H; |
| InChIKey | NQNSSFSVTNILCU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.65 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 131863452 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131863452?
The IUPAC name of CID 131863452 (CID 131863452) is not available.
What is the SMILES notation for CID 131863452?
The canonical SMILES for CID 131863452 is N#CC(=NO)S(=O)(=O)c1ccc(Cl)cc1.[Na].
What is the InChIKey of CID 131863452?
The InChIKey is NQNSSFSVTNILCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O3S.Na/c9-6-1-3-7(4-2-6)15(13,14)8(5-10)11-12;/h1-4,12H;.
What are the key properties of CID 131863452?
CID 131863452 has a molecular weight of 267.65 g/mol, XLogP of 1.04, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131863452 is sourced from PubChem (CID 131863452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).