C12H22O3 — CID 131871839
(E,2S,6S)-6-hydroxy-2,6,7,7-tetramethyloct-3-enoic acid (PubChem CID 131871839) has the molecular formula C12H22O3 and a molecular weight of 214.31 g/mol. Its IUPAC name is (E,2S,6S)-6-hydroxy-2,6,7,7-tetramethyloct-3-enoic acid.
| Compound Name | (E,2S,6S)-6-hydroxy-2,6,7,7-tetramethyloct-3-enoic acid |
|---|---|
| PubChem CID | 131871839 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | (E,2S,6S)-6-hydroxy-2,6,7,7-tetramethyloct-3-enoic acid |
| SMILES | C[C@@H](/C=C/C[C@](C)(O)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H22O3/c1-9(10(13)14)7-6-8-12(5,15)11(2,3)4/h6-7,9,15H,8H2,1-5H3,(H,13,14)/b7-6+/t9-,12-/m0/s1 |
| InChIKey | CEGLTVKGKAWWPU-NQSFLYKLSA-N |
| XLogP | 2.45 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|