C12H26O3Si — CID 131875975
[(4R)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol (PubChem CID 131875975) has the molecular formula C12H26O3Si and a molecular weight of 246.42 g/mol. Its IUPAC name is [(4R)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol.
| Compound Name | [(4R)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol |
|---|---|
| PubChem CID | 131875975 |
| Molecular Formula | C12H26O3Si |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | [(4R)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OCC[C@H](CO)O1 |
| InChI | InChI=1S/C12H26O3Si/c1-11(2,3)16(12(4,5)6)14-8-7-10(9-13)15-16/h10,13H,7-9H2,1-6H3/t10-/m1/s1 |
| InChIKey | KOPIEMINVAEFKZ-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|