C19H30O5Si — CID 528203
methyl 2,2-ditert-butyl-4-(hydroxymethyl)-4,5-dihydro-1,3,2-benzodioxasilepine-9-carboxylate (PubChem CID 528203) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is methyl 2,2-ditert-butyl-4-(hydroxymethyl)-4,5-dihydro-1,3,2-benzodioxasilepine-9-carboxylate.
| Compound Name | methyl 2,2-ditert-butyl-4-(hydroxymethyl)-4,5-dihydro-1,3,2-benzodioxasilepine-9-carboxylate |
|---|---|
| PubChem CID | 528203 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | methyl 2,2-ditert-butyl-4-(hydroxymethyl)-4,5-dihydro-1,3,2-benzodioxasilepine-9-carboxylate |
| SMILES | COC(=O)c1cccc2c1O[Si](C(C)(C)C)(C(C)(C)C)OC(CO)C2 |
| InChI | InChI=1S/C19H30O5Si/c1-18(2,3)25(19(4,5)6)23-14(12-20)11-13-9-8-10-15(16(13)24-25)17(21)22-7/h8-10,14,20H,11-12H2,1-7H3 |
| InChIKey | KNFJZDWVRZYTKT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|