C12H13NO4 — CID 141354463
methyl 2-acetamido-2,3-dihydro-1-benzofuran-7-carboxylate (PubChem CID 141354463) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 2-acetamido-2,3-dihydro-1-benzofuran-7-carboxylate.
| Compound Name | methyl 2-acetamido-2,3-dihydro-1-benzofuran-7-carboxylate |
|---|---|
| PubChem CID | 141354463 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 2-acetamido-2,3-dihydro-1-benzofuran-7-carboxylate |
| SMILES | COC(=O)c1cccc2c1OC(NC(C)=O)C2 |
| InChI | InChI=1S/C12H13NO4/c1-7(14)13-10-6-8-4-3-5-9(11(8)17-10)12(15)16-2/h3-5,10H,6H2,1-2H3,(H,13,14) |
| InChIKey | MWKJTDGKKJQXCJ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |