C13H27N3O3Si — CID 101386785
[(4S,5S)-5-(azidomethyl)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol (PubChem CID 101386785) has the molecular formula C13H27N3O3Si and a molecular weight of 301.46 g/mol. Its IUPAC name is [(4S,5S)-5-(azidomethyl)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol.
| Compound Name | [(4S,5S)-5-(azidomethyl)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol |
|---|---|
| PubChem CID | 101386785 |
| Molecular Formula | C13H27N3O3Si |
| Molecular Weight | 301.46 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | [(4S,5S)-5-(azidomethyl)-2,2-ditert-butyl-1,3,2-dioxasilinan-4-yl]methanol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H](CN=[N+]=[N-])[C@@H](CO)O1 |
| InChI | InChI=1S/C13H27N3O3Si/c1-12(2,3)20(13(4,5)6)18-9-10(7-15-16-14)11(8-17)19-20/h10-11,17H,7-9H2,1-6H3/t10-,11+/m0/s1 |
| InChIKey | ODWCEQLIYBNJRZ-WDEREUQCSA-N |
| XLogP | 3.36 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|