C28H58N2O8P2 — CID 131877973
1-[bis(3-methylbutoxy)phosphoryl]-N-[6-[bis(3-methylbutoxy)phosphorylcarbonylamino]hexyl]formamide (PubChem CID 131877973) has the molecular formula C28H58N2O8P2 and a molecular weight of 612.73 g/mol. Its IUPAC name is 1-[bis(3-methylbutoxy)phosphoryl]-N-[6-[bis(3-methylbutoxy)phosphorylcarbonylamino]hexyl]formamide.
| Compound Name | 1-[bis(3-methylbutoxy)phosphoryl]-N-[6-[bis(3-methylbutoxy)phosphorylcarbonylamino]hexyl]formamide |
|---|---|
| PubChem CID | 131877973 |
| Molecular Formula | C28H58N2O8P2 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.37 |
| IUPAC Name | 1-[bis(3-methylbutoxy)phosphoryl]-N-[6-[bis(3-methylbutoxy)phosphorylcarbonylamino]hexyl]formamide |
| SMILES | CC(C)CCOP(=O)(OCCC(C)C)C(=O)NCCCCCCNC(=O)P(=O)(OCCC(C)C)OCCC(C)C |
| InChI | InChI=1S/C28H58N2O8P2/c1-23(2)13-19-35-39(33,36-20-14-24(3)4)27(31)29-17-11-9-10-12-18-30-28(32)40(34,37-21-15-25(5)6)38-22-16-26(7)8/h23-26H,9-22H2,1-8H3,(H,29,31)(H,30,32) |
| InChIKey | IMFQDPCPYOSWME-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|