C21H32O3 — CID 131880569
(1S,2S,3S,6R,8R,11S,12S,15S,16S,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosan-6-ol (PubChem CID 131880569) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is (1S,2S,3S,6R,8R,11S,12S,15S,16S,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosan-6-ol.
| Compound Name | (1S,2S,3S,6R,8R,11S,12S,15S,16S,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosan-6-ol |
|---|---|
| PubChem CID | 131880569 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | (1S,2S,3S,6R,8R,11S,12S,15S,16S,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosan-6-ol |
| SMILES | C[C@@H]1OC2O[C@H]3C[C@@]24[C@@H]1CC[C@H]4[C@@H]1CC[C@@H]2C[C@H](O)CC[C@]2(C)[C@H]13 |
| InChI | InChI=1S/C21H32O3/c1-11-15-5-6-16-14-4-3-12-9-13(22)7-8-20(12,2)18(14)17-10-21(15,16)19(23-11)24-17/h11-19,22H,3-10H2,1-2H3/t11-,12+,13+,14-,15+,16-,17-,18+,19?,20-,21-/m0/s1 |
| InChIKey | PDRIWHNWBPWLNX-VSFGJRKXSA-N |
| XLogP | 3.74 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |