C21H32O4 — CID 24843107
(1R,2S,3S,6S,8S,11S,12S,15S,16R,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosane-6,16-diol (PubChem CID 24843107) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,2S,3S,6S,8S,11S,12S,15S,16R,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosane-6,16-diol.
| Compound Name | (1R,2S,3S,6S,8S,11S,12S,15S,16R,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosane-6,16-diol |
|---|---|
| PubChem CID | 24843107 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,2S,3S,6S,8S,11S,12S,15S,16R,19R)-3,16-dimethyl-17,21-dioxahexacyclo[16.2.1.02,11.03,8.012,19.015,19]henicosane-6,16-diol |
| SMILES | C[C@]12CC[C@H](O)C[C@@H]1CC[C@@H]1[C@@H]2[C@H]2C[C@]34C(O2)O[C@@](C)(O)[C@H]3CC[C@@H]14 |
| InChI | InChI=1S/C21H32O4/c1-19-8-7-12(22)9-11(19)3-4-13-14-5-6-16-20(2,23)25-18-21(14,16)10-15(24-18)17(13)19/h11-18,22-23H,3-10H2,1-2H3/t11-,12-,13-,14-,15+,16+,17+,18?,19-,20+,21+/m0/s1 |
| InChIKey | ISQYOFCPHAZHTP-MAOPHPSTSA-N |
| XLogP | 3.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |