C11H10O2S — CID 131881209
2-[(4-methoxyphenyl)methylidene]thietan-3-one (PubChem CID 131881209) has the molecular formula C11H10O2S and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-[(4-methoxyphenyl)methylidene]thietan-3-one.
| Compound Name | 2-[(4-methoxyphenyl)methylidene]thietan-3-one |
|---|---|
| PubChem CID | 131881209 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-[(4-methoxyphenyl)methylidene]thietan-3-one |
| SMILES | COc1ccc(C=C2SCC2=O)cc1 |
| InChI | InChI=1S/C11H10O2S/c1-13-9-4-2-8(3-5-9)6-11-10(12)7-14-11/h2-6H,7H2,1H3 |
| InChIKey | DRSZCBYQCQBTSD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|