C11H17NO3 — CID 131881589
[(7S,8R,8aS)-8-ethyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate (PubChem CID 131881589) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is [(7S,8R,8aS)-8-ethyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate.
| Compound Name | [(7S,8R,8aS)-8-ethyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate |
|---|---|
| PubChem CID | 131881589 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [(7S,8R,8aS)-8-ethyl-3-oxo-2,5,6,7,8,8a-hexahydro-1H-indolizin-7-yl] formate |
| SMILES | CC[C@H]1[C@@H](OC=O)CCN2C(=O)CC[C@@H]12 |
| InChI | InChI=1S/C11H17NO3/c1-2-8-9-3-4-11(14)12(9)6-5-10(8)15-7-13/h7-10H,2-6H2,1H3/t8-,9+,10+/m1/s1 |
| InChIKey | YUDZRSVDNROFBT-UTLUCORTSA-N |
| XLogP | 0.95 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|