C12H19NO — CID 175973761
7-ethyl-6-propan-2-ylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 175973761) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 7-ethyl-6-propan-2-ylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | 7-ethyl-6-propan-2-ylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 175973761 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 7-ethyl-6-propan-2-ylidene-2,5,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | CCC1C(=C(C)C)CN2C(=O)CCC12 |
| InChI | InChI=1S/C12H19NO/c1-4-9-10(8(2)3)7-13-11(9)5-6-12(13)14/h9,11H,4-7H2,1-3H3 |
| InChIKey | PHZOXPPLCXLPOX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|