C22H22O5 — CID 131883073
7-benzhydryl-7-hydroxybicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 131883073) has the molecular formula C22H22O5 and a molecular weight of 366.41 g/mol. Its IUPAC name is 7-benzhydryl-7-hydroxybicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
| Compound Name | 7-benzhydryl-7-hydroxybicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 131883073 |
| Molecular Formula | C22H22O5 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 7-benzhydryl-7-hydroxybicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)C2CCC1C2(O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H22O5/c23-20(24)17-15-11-12-16(18(17)21(25)26)22(15,27)19(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-19,27H,11-12H2,(H,23,24)(H,25,26) |
| InChIKey | JZZQUYLCDAOQRK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |