C13H21ClN2O4 — CID 131883580
(3R,4S,5R)-2-(2-amino-4,5-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride (PubChem CID 131883580) has the molecular formula C13H21ClN2O4 and a molecular weight of 304.77 g/mol. Its IUPAC name is (3R,4S,5R)-2-(2-amino-4,5-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride.
| Compound Name | (3R,4S,5R)-2-(2-amino-4,5-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride |
|---|---|
| PubChem CID | 131883580 |
| Molecular Formula | C13H21ClN2O4 |
| Molecular Weight | 304.77 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (3R,4S,5R)-2-(2-amino-4,5-dimethylanilino)-5-(hydroxymethyl)oxolane-3,4-diol;hydrochloride |
| SMILES | Cc1cc(N)c(NC2O[C@H](CO)[C@@H](O)[C@H]2O)cc1C.Cl |
| InChI | InChI=1S/C13H20N2O4.ClH/c1-6-3-8(14)9(4-7(6)2)15-13-12(18)11(17)10(5-16)19-13;/h3-4,10-13,15-18H,5,14H2,1-2H3;1H/t10-,11-,12-,13?;/m1./s1 |
| InChIKey | SWOSFQHGCFTSRW-NHEXWIJFSA-N |
| XLogP | 0.16 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.77 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|