C19H25N3O4 — CID 617164
5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol (PubChem CID 617164) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol.
| Compound Name | 5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 617164 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 5-(4,5-dimethyl-2-phenyldiazenylanilino)pentane-1,2,3,4-tetrol |
| SMILES | Cc1cc(/N=N/c2ccccc2)c(NCC(O)C(O)C(O)CO)cc1C |
| InChI | InChI=1S/C19H25N3O4/c1-12-8-15(20-10-17(24)19(26)18(25)11-23)16(9-13(12)2)22-21-14-6-4-3-5-7-14/h3-9,17-20,23-26H,10-11H2,1-2H3/b22-21+ |
| InChIKey | NARUXRZZSJCXFJ-QURGRASLSA-N |
| XLogP | 2.21 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|