C13H15NO4 — CID 131886085
5,6-dihydroxy-3-methyl-4-propyl-1H-indole-2-carboxylic acid (PubChem CID 131886085) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 5,6-dihydroxy-3-methyl-4-propyl-1H-indole-2-carboxylic acid.
| Compound Name | 5,6-dihydroxy-3-methyl-4-propyl-1H-indole-2-carboxylic acid |
|---|---|
| PubChem CID | 131886085 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 5,6-dihydroxy-3-methyl-4-propyl-1H-indole-2-carboxylic acid |
| SMILES | CCCc1c(O)c(O)cc2[nH]c(C(=O)O)c(C)c12 |
| InChI | InChI=1S/C13H15NO4/c1-3-4-7-10-6(2)11(13(17)18)14-8(10)5-9(15)12(7)16/h5,14-16H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | WINPPPVWSXNDTJ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|